C15H23O7P2-3 — CID 129320387
[oxido-[(2E,4E,6E)-3,7,11-trimethyldodeca-2,4,6,10-tetraenoxy]phosphoryl] phosphate (PubChem CID 129320387) has the molecular formula C15H23O7P2-3 and a molecular weight of 377.29 g/mol. Its IUPAC name is [oxido-[(2E,4E,6E)-3,7,11-trimethyldodeca-2,4,6,10-tetraenoxy]phosphoryl] phosphate.
| Compound Name | [oxido-[(2E,4E,6E)-3,7,11-trimethyldodeca-2,4,6,10-tetraenoxy]phosphoryl] phosphate |
|---|---|
| PubChem CID | 129320387 |
| Molecular Formula | C15H23O7P2-3 |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | [oxido-[(2E,4E,6E)-3,7,11-trimethyldodeca-2,4,6,10-tetraenoxy]phosphoryl] phosphate |
| SMILES | CC(C)=CCC/C(C)=C/C=C/C(C)=C/COP(=O)([O-])OP(=O)([O-])[O-] |
| InChI | InChI=1S/C15H26O7P2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-21-24(19,20)22-23(16,17)18/h6-7,9-11H,5,8,12H2,1-4H3,(H,19,20)(H2,16,17,18)/p-3/b10-6+,14-9+,15-11+ |
| InChIKey | VWUIKNIMFVYWDA-KYPPLYASSA-K |
| XLogP | 2.51 |
| TPSA | 121.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|