C11H19N3O5 — CID 129320388
(2S)-2-[[(E,2S)-2-[[(2S)-2-azaniumylpropanoyl]amino]-4-methoxybut-3-enoyl]amino]propanoate (PubChem CID 129320388) has the molecular formula C11H19N3O5 and a molecular weight of 273.29 g/mol. Its IUPAC name is (2S)-2-[[(E,2S)-2-[[(2S)-2-azaniumylpropanoyl]amino]-4-methoxybut-3-enoyl]amino]propanoate.
| Compound Name | (2S)-2-[[(E,2S)-2-[[(2S)-2-azaniumylpropanoyl]amino]-4-methoxybut-3-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 129320388 |
| Molecular Formula | C11H19N3O5 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (2S)-2-[[(E,2S)-2-[[(2S)-2-azaniumylpropanoyl]amino]-4-methoxybut-3-enoyl]amino]propanoate |
| SMILES | CO/C=C/[C@H](NC(=O)[C@H](C)[NH3+])C(=O)N[C@@H](C)C(=O)[O-] |
| InChI | InChI=1S/C11H19N3O5/c1-6(12)9(15)14-8(4-5-19-3)10(16)13-7(2)11(17)18/h4-8H,12H2,1-3H3,(H,13,16)(H,14,15)(H,17,18)/b5-4+/t6-,7-,8-/m0/s1 |
| InChIKey | GCYMRSXFQNUOET-AAOVDQSGSA-N |
| XLogP | -3.48 |
| TPSA | 135.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | -3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|