C12H20NO+ — CID 129320392
[(2E,5S,6E,8E,10E)-5-hydroxydodeca-2,6,8,10-tetraenyl]azanium (PubChem CID 129320392) has the molecular formula C12H20NO+ and a molecular weight of 194.30 g/mol. Its IUPAC name is [(2E,5S,6E,8E,10E)-5-hydroxydodeca-2,6,8,10-tetraenyl]azanium.
| Compound Name | [(2E,5S,6E,8E,10E)-5-hydroxydodeca-2,6,8,10-tetraenyl]azanium |
|---|---|
| PubChem CID | 129320392 |
| Molecular Formula | C12H20NO+ |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | [(2E,5S,6E,8E,10E)-5-hydroxydodeca-2,6,8,10-tetraenyl]azanium |
| SMILES | C/C=C/C=C/C=C/[C@@H](O)C/C=C/C[NH3+] |
| InChI | InChI=1S/C12H19NO/c1-2-3-4-5-6-9-12(14)10-7-8-11-13/h2-9,12,14H,10-11,13H2,1H3/p+1/b3-2+,5-4+,8-7+,9-6+/t12-/m1/s1 |
| InChIKey | IWHNBGKZOVCSTH-QHHLHPODSA-O |
| XLogP | 1.22 |
| TPSA | 47.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|