C12H19NO — CID 129320393
(2E,5S,6E,8E,10E)-1-aminododeca-2,6,8,10-tetraen-5-ol (PubChem CID 129320393) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (2E,5S,6E,8E,10E)-1-aminododeca-2,6,8,10-tetraen-5-ol.
| Compound Name | (2E,5S,6E,8E,10E)-1-aminododeca-2,6,8,10-tetraen-5-ol |
|---|---|
| PubChem CID | 129320393 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (2E,5S,6E,8E,10E)-1-aminododeca-2,6,8,10-tetraen-5-ol |
| SMILES | C/C=C/C=C/C=C/[C@@H](O)C/C=C/CN |
| InChI | InChI=1S/C12H19NO/c1-2-3-4-5-6-9-12(14)10-7-8-11-13/h2-9,12,14H,10-11,13H2,1H3/b3-2+,5-4+,8-7+,9-6+/t12-/m1/s1 |
| InChIKey | IWHNBGKZOVCSTH-QHHLHPODSA-N |
| XLogP | 1.94 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|