About 5-chloro-4-N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]pyrimidine-4,6-diamine
5-chloro-4-N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]pyrimidine-4,6-diamine (PubChem CID 129320709) has the molecular formula C11H17ClN4O
and a molecular weight of 256.74 g/mol. Its IUPAC name is 5-chloro-4-N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]pyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 5-chloro-4-N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]pyrimidine-4,6-diamine |
| PubChem CID | 129320709 |
| Molecular Formula | C11H17ClN4O |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 5-chloro-4-N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]pyrimidine-4,6-diamine |
| SMILES | CC1(C)CC[C@@H](CNc2ncnc(N)c2Cl)O1 |
| InChI | InChI=1S/C11H17ClN4O/c1-11(2)4-3-7(17-11)5-14-10-8(12)9(13)15-6-16-10/h6-7H,3-5H2,1-2H3,(H3,13,14,15,16)/t7-/m0/s1 |
| InChIKey | SYQNVGYPSJIAGQ-ZETCQYMHSA-N |
| XLogP | 2.08 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-4-N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]pyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]pyrimidine-4,6-diamine?
The IUPAC name of 5-chloro-4-N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]pyrimidine-4,6-diamine (CID 129320709) is 5-chloro-4-N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]pyrimidine-4,6-diamine.
What is the SMILES notation for 5-chloro-4-N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]pyrimidine-4,6-diamine?
The canonical SMILES for 5-chloro-4-N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]pyrimidine-4,6-diamine is CC1(C)CC[C@@H](CNc2ncnc(N)c2Cl)O1.
What is the InChIKey of 5-chloro-4-N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]pyrimidine-4,6-diamine?
The InChIKey is SYQNVGYPSJIAGQ-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H17ClN4O/c1-11(2)4-3-7(17-11)5-14-10-8(12)9(13)15-6-16-10/h6-7H,3-5H2,1-2H3,(H3,13,14,15,16)/t7-/m0/s1.
What are the key properties of 5-chloro-4-N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]pyrimidine-4,6-diamine?
5-chloro-4-N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]pyrimidine-4,6-diamine has a molecular weight of 256.74 g/mol, XLogP of 2.08, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-N-[[(2S)-5,5-dimethyloxolan-2-yl]methyl]pyrimidine-4,6-diamine is sourced from PubChem (CID 129320709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).