C7H12N2O3 — CID 129321124
(3R,6S)-3-[(1S)-1-hydroxyethyl]-6-methylpiperazine-2,5-dione (PubChem CID 129321124) has the molecular formula C7H12N2O3 and a molecular weight of 172.18 g/mol. Its IUPAC name is (3R,6S)-3-[(1S)-1-hydroxyethyl]-6-methylpiperazine-2,5-dione.
| Compound Name | (3R,6S)-3-[(1S)-1-hydroxyethyl]-6-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 129321124 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | (3R,6S)-3-[(1S)-1-hydroxyethyl]-6-methylpiperazine-2,5-dione |
| SMILES | C[C@@H]1NC(=O)[C@@H]([C@H](C)O)NC1=O |
| InChI | InChI=1S/C7H12N2O3/c1-3-6(11)9-5(4(2)10)7(12)8-3/h3-5,10H,1-2H3,(H,8,12)(H,9,11)/t3-,4-,5+/m0/s1 |
| InChIKey | RPQRZNMWYOGSBZ-VAYJURFESA-N |
| XLogP | -1.63 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |