About (2R,4S)-4-methylhexane-1,2,6-triol
(2R,4S)-4-methylhexane-1,2,6-triol (PubChem CID 129321389) has the molecular formula C7H16O3
and a molecular weight of 148.20 g/mol. Its IUPAC name is (2R,4S)-4-methylhexane-1,2,6-triol.
Molecular Properties
| Compound Name | (2R,4S)-4-methylhexane-1,2,6-triol |
| PubChem CID | 129321389 |
| Molecular Formula | C7H16O3 |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.11 |
| IUPAC Name | (2R,4S)-4-methylhexane-1,2,6-triol |
| SMILES | C[C@@H](CCO)C[C@@H](O)CO |
| InChI | InChI=1S/C7H16O3/c1-6(2-3-8)4-7(10)5-9/h6-10H,2-5H2,1H3/t6-,7+/m0/s1 |
| InChIKey | ASIVSHMOKCMYPA-NKWVEPMBSA-N |
| XLogP | -0.25 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R,4S)-4-methylhexane-1,2,6-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-4-methylhexane-1,2,6-triol?
The IUPAC name of (2R,4S)-4-methylhexane-1,2,6-triol (CID 129321389) is (2R,4S)-4-methylhexane-1,2,6-triol.
What is the SMILES notation for (2R,4S)-4-methylhexane-1,2,6-triol?
The canonical SMILES for (2R,4S)-4-methylhexane-1,2,6-triol is C[C@@H](CCO)C[C@@H](O)CO.
What is the InChIKey of (2R,4S)-4-methylhexane-1,2,6-triol?
The InChIKey is ASIVSHMOKCMYPA-NKWVEPMBSA-N. The full InChI is InChI=1S/C7H16O3/c1-6(2-3-8)4-7(10)5-9/h6-10H,2-5H2,1H3/t6-,7+/m0/s1.
What are the key properties of (2R,4S)-4-methylhexane-1,2,6-triol?
(2R,4S)-4-methylhexane-1,2,6-triol has a molecular weight of 148.20 g/mol, XLogP of -0.25, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-4-methylhexane-1,2,6-triol is sourced from PubChem (CID 129321389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).