C12H18BN3O4 — CID 129321624
methyl 3-amino-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine-2-carboxylate (PubChem CID 129321624) has the molecular formula C12H18BN3O4 and a molecular weight of 279.11 g/mol. Its IUPAC name is methyl 3-amino-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine-2-carboxylate.
| Compound Name | methyl 3-amino-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 129321624 |
| Molecular Formula | C12H18BN3O4 |
| Molecular Weight | 279.11 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | methyl 3-amino-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazine-2-carboxylate |
| SMILES | COC(=O)c1nc(B2OC(C)(C)C(C)(C)O2)cnc1N |
| InChI | InChI=1S/C12H18BN3O4/c1-11(2)12(3,4)20-13(19-11)7-6-15-9(14)8(16-7)10(17)18-5/h6H,1-5H3,(H2,14,15) |
| InChIKey | XHRLHTTZNZPOSU-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 96.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.11 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|