About (2R)-2-[(2E)-penta-2,4-dienyl]cyclohexan-1-one
(2R)-2-[(2E)-penta-2,4-dienyl]cyclohexan-1-one (PubChem CID 129321670) has the molecular formula C11H16O
and a molecular weight of 164.25 g/mol. Its IUPAC name is (2R)-2-[(2E)-penta-2,4-dienyl]cyclohexan-1-one.
Molecular Properties
| Compound Name | (2R)-2-[(2E)-penta-2,4-dienyl]cyclohexan-1-one |
| PubChem CID | 129321670 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (2R)-2-[(2E)-penta-2,4-dienyl]cyclohexan-1-one |
| SMILES | C=C/C=C/C[C@H]1CCCCC1=O |
| InChI | InChI=1S/C11H16O/c1-2-3-4-7-10-8-5-6-9-11(10)12/h2-4,10H,1,5-9H2/b4-3+/t10-/m0/s1 |
| InChIKey | VXQRTHHOMHBQSN-FSIBCCDJSA-N |
| XLogP | 2.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(2E)-penta-2,4-dienyl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(2E)-penta-2,4-dienyl]cyclohexan-1-one?
The IUPAC name of (2R)-2-[(2E)-penta-2,4-dienyl]cyclohexan-1-one (CID 129321670) is (2R)-2-[(2E)-penta-2,4-dienyl]cyclohexan-1-one.
What is the SMILES notation for (2R)-2-[(2E)-penta-2,4-dienyl]cyclohexan-1-one?
The canonical SMILES for (2R)-2-[(2E)-penta-2,4-dienyl]cyclohexan-1-one is C=C/C=C/C[C@H]1CCCCC1=O.
What is the InChIKey of (2R)-2-[(2E)-penta-2,4-dienyl]cyclohexan-1-one?
The InChIKey is VXQRTHHOMHBQSN-FSIBCCDJSA-N. The full InChI is InChI=1S/C11H16O/c1-2-3-4-7-10-8-5-6-9-11(10)12/h2-4,10H,1,5-9H2/b4-3+/t10-/m0/s1.
What are the key properties of (2R)-2-[(2E)-penta-2,4-dienyl]cyclohexan-1-one?
(2R)-2-[(2E)-penta-2,4-dienyl]cyclohexan-1-one has a molecular weight of 164.25 g/mol, XLogP of 2.88, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(2E)-penta-2,4-dienyl]cyclohexan-1-one is sourced from PubChem (CID 129321670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).