About trans-(1R,2R)-2-(1-methylpyrazol-3-yl)cyclopropane-1-carboxylic acid
trans-(1R,2R)-2-(1-methylpyrazol-3-yl)cyclopropane-1-carboxylic acid (PubChem CID 129321797) has the molecular formula C8H10N2O2
and a molecular weight of 166.18 g/mol. Its IUPAC name is trans-(1R,2R)-2-(1-methylpyrazol-3-yl)cyclopropane-1-carboxylic acid.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-(1-methylpyrazol-3-yl)cyclopropane-1-carboxylic acid |
| PubChem CID | 129321797 |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.07 |
| IUPAC Name | trans-(1R,2R)-2-(1-methylpyrazol-3-yl)cyclopropane-1-carboxylic acid |
| SMILES | Cn1ccc([C@@H]2C[C@H]2C(=O)O)n1 |
| InChI | InChI=1S/C8H10N2O2/c1-10-3-2-7(9-10)5-4-6(5)8(11)12/h2-3,5-6H,4H2,1H3,(H,11,12)/t5-,6-/m1/s1 |
| InChIKey | RGWHFGCVORFMCD-PHDIDXHHSA-N |
| XLogP | 0.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-(1R,2R)-2-(1-methylpyrazol-3-yl)cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-(1-methylpyrazol-3-yl)cyclopropane-1-carboxylic acid?
The IUPAC name of trans-(1R,2R)-2-(1-methylpyrazol-3-yl)cyclopropane-1-carboxylic acid (CID 129321797) is trans-(1R,2R)-2-(1-methylpyrazol-3-yl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for trans-(1R,2R)-2-(1-methylpyrazol-3-yl)cyclopropane-1-carboxylic acid?
The canonical SMILES for trans-(1R,2R)-2-(1-methylpyrazol-3-yl)cyclopropane-1-carboxylic acid is Cn1ccc([C@@H]2C[C@H]2C(=O)O)n1.
What is the InChIKey of trans-(1R,2R)-2-(1-methylpyrazol-3-yl)cyclopropane-1-carboxylic acid?
The InChIKey is RGWHFGCVORFMCD-PHDIDXHHSA-N. The full InChI is InChI=1S/C8H10N2O2/c1-10-3-2-7(9-10)5-4-6(5)8(11)12/h2-3,5-6H,4H2,1H3,(H,11,12)/t5-,6-/m1/s1.
What are the key properties of trans-(1R,2R)-2-(1-methylpyrazol-3-yl)cyclopropane-1-carboxylic acid?
trans-(1R,2R)-2-(1-methylpyrazol-3-yl)cyclopropane-1-carboxylic acid has a molecular weight of 166.18 g/mol, XLogP of 0.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-(1-methylpyrazol-3-yl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 129321797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).