C10H10N2O2 — CID 129322020
(1R,2S,3S,4S,5R,6S,7R,8R)-5,6-dihydroxytricyclo[5.1.0.02,4]octane-3,8-dicarbonitrile (PubChem CID 129322020) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is (1R,2S,3S,4S,5R,6S,7R,8R)-5,6-dihydroxytricyclo[5.1.0.02,4]octane-3,8-dicarbonitrile.
| Compound Name | (1R,2S,3S,4S,5R,6S,7R,8R)-5,6-dihydroxytricyclo[5.1.0.02,4]octane-3,8-dicarbonitrile |
|---|---|
| PubChem CID | 129322020 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | (1R,2S,3S,4S,5R,6S,7R,8R)-5,6-dihydroxytricyclo[5.1.0.02,4]octane-3,8-dicarbonitrile |
| SMILES | N#C[C@@H]1[C@H]2[C@H]3[C@H](C#N)[C@H]3[C@@H](O)[C@@H](O)[C@@H]12 |
| InChI | InChI=1S/C10H10N2O2/c11-1-3-5-6-4(2-12)8(6)10(14)9(13)7(3)5/h3-10,13-14H/t3-,4+,5+,6-,7+,8-,9+,10- |
| InChIKey | MOKNGASMFPZNDI-YTAQVTJYSA-N |
| XLogP | -0.51 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |