C12H21NO — CID 129322188
(3aR,5S,7aS)-5-[(dimethylamino)methyl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-one (PubChem CID 129322188) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (3aR,5S,7aS)-5-[(dimethylamino)methyl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-one.
| Compound Name | (3aR,5S,7aS)-5-[(dimethylamino)methyl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-one |
|---|---|
| PubChem CID | 129322188 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (3aR,5S,7aS)-5-[(dimethylamino)methyl]-1,2,3,3a,5,6,7,7a-octahydroinden-4-one |
| SMILES | CN(C)C[C@@H]1CC[C@@H]2CCC[C@H]2C1=O |
| InChI | InChI=1S/C12H21NO/c1-13(2)8-10-7-6-9-4-3-5-11(9)12(10)14/h9-11H,3-8H2,1-2H3/t9-,10-,11+/m0/s1 |
| InChIKey | YRWKWFMEGOHEPT-GARJFASQSA-N |
| XLogP | 1.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |