C8H16O3 — CID 129322406
(2S,3R,4S)-4-methoxy-2-methylhex-5-ene-1,3-diol (PubChem CID 129322406) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (2S,3R,4S)-4-methoxy-2-methylhex-5-ene-1,3-diol.
| Compound Name | (2S,3R,4S)-4-methoxy-2-methylhex-5-ene-1,3-diol |
|---|---|
| PubChem CID | 129322406 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (2S,3R,4S)-4-methoxy-2-methylhex-5-ene-1,3-diol |
| SMILES | C=C[C@H](OC)[C@H](O)[C@@H](C)CO |
| InChI | InChI=1S/C8H16O3/c1-4-7(11-3)8(10)6(2)5-9/h4,6-10H,1,5H2,2-3H3/t6-,7-,8+/m0/s1 |
| InChIKey | SHIQMNIXCAMIAB-BIIVOSGPSA-N |
| XLogP | 0.18 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|