C11H17N3O2 — CID 129322903
6-[[(1R,2R)-2-methylcyclohexyl]amino]-1H-pyrimidine-2,4-dione (PubChem CID 129322903) has the molecular formula C11H17N3O2 and a molecular weight of 223.28 g/mol. Its IUPAC name is 6-[[(1R,2R)-2-methylcyclohexyl]amino]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-[[(1R,2R)-2-methylcyclohexyl]amino]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 129322903 |
| Molecular Formula | C11H17N3O2 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.13 |
| IUPAC Name | 6-[[(1R,2R)-2-methylcyclohexyl]amino]-1H-pyrimidine-2,4-dione |
| SMILES | C[C@@H]1CCCC[C@H]1Nc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C11H17N3O2/c1-7-4-2-3-5-8(7)12-9-6-10(15)14-11(16)13-9/h6-8H,2-5H2,1H3,(H3,12,13,14,15,16)/t7-,8-/m1/s1 |
| InChIKey | BIBSEXVVUDLFFD-HTQZYQBOSA-N |
| XLogP | 1.05 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |