About N-[(3S)-1-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]piperidin-3-yl]methanesulfonamide
N-[(3S)-1-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]piperidin-3-yl]methanesulfonamide (PubChem CID 129323229) has the molecular formula C15H21N3O3S
and a molecular weight of 323.42 g/mol. Its IUPAC name is N-[(3S)-1-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]piperidin-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[(3S)-1-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]piperidin-3-yl]methanesulfonamide |
| PubChem CID | 129323229 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-[(3S)-1-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]piperidin-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@H]1CCCN(C(=O)[C@H]2Cc3ccccc3N2)C1 |
| InChI | InChI=1S/C15H21N3O3S/c1-22(20,21)17-12-6-4-8-18(10-12)15(19)14-9-11-5-2-3-7-13(11)16-14/h2-3,5,7,12,14,16-17H,4,6,8-10H2,1H3/t12-,14+/m0/s1 |
| InChIKey | DGPLSVDPYXBBTK-GXTWGEPZSA-N |
| XLogP | 0.56 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3S)-1-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]piperidin-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S)-1-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]piperidin-3-yl]methanesulfonamide?
The IUPAC name of N-[(3S)-1-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]piperidin-3-yl]methanesulfonamide (CID 129323229) is N-[(3S)-1-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]piperidin-3-yl]methanesulfonamide.
What is the SMILES notation for N-[(3S)-1-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]piperidin-3-yl]methanesulfonamide?
The canonical SMILES for N-[(3S)-1-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]piperidin-3-yl]methanesulfonamide is CS(=O)(=O)N[C@H]1CCCN(C(=O)[C@H]2Cc3ccccc3N2)C1.
What is the InChIKey of N-[(3S)-1-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]piperidin-3-yl]methanesulfonamide?
The InChIKey is DGPLSVDPYXBBTK-GXTWGEPZSA-N. The full InChI is InChI=1S/C15H21N3O3S/c1-22(20,21)17-12-6-4-8-18(10-12)15(19)14-9-11-5-2-3-7-13(11)16-14/h2-3,5,7,12,14,16-17H,4,6,8-10H2,1H3/t12-,14+/m0/s1.
What are the key properties of N-[(3S)-1-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]piperidin-3-yl]methanesulfonamide?
N-[(3S)-1-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]piperidin-3-yl]methanesulfonamide has a molecular weight of 323.42 g/mol, XLogP of 0.56, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S)-1-[(2R)-2,3-dihydro-1H-indole-2-carbonyl]piperidin-3-yl]methanesulfonamide is sourced from PubChem (CID 129323229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).