C17H25N3O4 — CID 129323811
2-[[(3R)-3-methyl-1-[2-oxo-2-(2-phenoxyethylamino)ethyl]pyrrolidin-3-yl]amino]acetic acid (PubChem CID 129323811) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-[[(3R)-3-methyl-1-[2-oxo-2-(2-phenoxyethylamino)ethyl]pyrrolidin-3-yl]amino]acetic acid.
| Compound Name | 2-[[(3R)-3-methyl-1-[2-oxo-2-(2-phenoxyethylamino)ethyl]pyrrolidin-3-yl]amino]acetic acid |
|---|---|
| PubChem CID | 129323811 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-[[(3R)-3-methyl-1-[2-oxo-2-(2-phenoxyethylamino)ethyl]pyrrolidin-3-yl]amino]acetic acid |
| SMILES | C[C@@]1(NCC(=O)O)CCN(CC(=O)NCCOc2ccccc2)C1 |
| InChI | InChI=1S/C17H25N3O4/c1-17(19-11-16(22)23)7-9-20(13-17)12-15(21)18-8-10-24-14-5-3-2-4-6-14/h2-6,19H,7-13H2,1H3,(H,18,21)(H,22,23)/t17-/m1/s1 |
| InChIKey | FNZGZWSVJVWHKI-QGZVFWFLSA-N |
| XLogP | 0.32 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|