About (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2,6-difluorobenzoate
(1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2,6-difluorobenzoate (PubChem CID 1293243) has the molecular formula C21H20F2N2O2S
and a molecular weight of 402.47 g/mol. Its IUPAC name is (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2,6-difluorobenzoate.
Molecular Properties
| Compound Name | (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2,6-difluorobenzoate |
| PubChem CID | 1293243 |
| Molecular Formula | C21H20F2N2O2S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2,6-difluorobenzoate |
| SMILES | Cc1nn(C(C)(C)C)c(OC(=O)c2c(F)cccc2F)c1Sc1ccccc1 |
| InChI | InChI=1S/C21H20F2N2O2S/c1-13-18(28-14-9-6-5-7-10-14)19(25(24-13)21(2,3)4)27-20(26)17-15(22)11-8-12-16(17)23/h5-12H,1-4H3 |
| InChIKey | CFTIQRQDSPKSFL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2,6-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2,6-difluorobenzoate?
The IUPAC name of (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2,6-difluorobenzoate (CID 1293243) is (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2,6-difluorobenzoate.
What is the SMILES notation for (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2,6-difluorobenzoate?
The canonical SMILES for (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2,6-difluorobenzoate is Cc1nn(C(C)(C)C)c(OC(=O)c2c(F)cccc2F)c1Sc1ccccc1.
What is the InChIKey of (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2,6-difluorobenzoate?
The InChIKey is CFTIQRQDSPKSFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20F2N2O2S/c1-13-18(28-14-9-6-5-7-10-14)19(25(24-13)21(2,3)4)27-20(26)17-15(22)11-8-12-16(17)23/h5-12H,1-4H3.
What are the key properties of (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2,6-difluorobenzoate?
(1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2,6-difluorobenzoate has a molecular weight of 402.47 g/mol, XLogP of 5.60, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-tert-butyl-3-methyl-4-phenylsulfanylpyrazol-5-yl) 2,6-difluorobenzoate is sourced from PubChem (CID 1293243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).