C19H33N3O4 — CID 129325101
2-[acetyl-[(4S)-1-[2-(cyclohexylmethylamino)-2-oxoethyl]azepan-4-yl]amino]acetic acid (PubChem CID 129325101) has the molecular formula C19H33N3O4 and a molecular weight of 367.49 g/mol. Its IUPAC name is 2-[acetyl-[(4S)-1-[2-(cyclohexylmethylamino)-2-oxoethyl]azepan-4-yl]amino]acetic acid.
| Compound Name | 2-[acetyl-[(4S)-1-[2-(cyclohexylmethylamino)-2-oxoethyl]azepan-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 129325101 |
| Molecular Formula | C19H33N3O4 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 2-[acetyl-[(4S)-1-[2-(cyclohexylmethylamino)-2-oxoethyl]azepan-4-yl]amino]acetic acid |
| SMILES | CC(=O)N(CC(=O)O)[C@H]1CCCN(CC(=O)NCC2CCCCC2)CC1 |
| InChI | InChI=1S/C19H33N3O4/c1-15(23)22(14-19(25)26)17-8-5-10-21(11-9-17)13-18(24)20-12-16-6-3-2-4-7-16/h16-17H,2-14H2,1H3,(H,20,24)(H,25,26)/t17-/m0/s1 |
| InChIKey | WDQJZEYBEOAENO-KRWDZBQOSA-N |
| XLogP | 1.47 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |