C17H19F3N4O2 — CID 129327632
N,2-dimethyl-6-oxo-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1H-pyridine-4-carboxamide (PubChem CID 129327632) has the molecular formula C17H19F3N4O2 and a molecular weight of 368.36 g/mol. Its IUPAC name is N,2-dimethyl-6-oxo-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1H-pyridine-4-carboxamide.
| Compound Name | N,2-dimethyl-6-oxo-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1H-pyridine-4-carboxamide |
|---|---|
| PubChem CID | 129327632 |
| Molecular Formula | C17H19F3N4O2 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | N,2-dimethyl-6-oxo-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]-1H-pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)C[C@H]2CCc3nc(C(F)(F)F)cn3C2)cc(=O)[nH]1 |
| InChI | InChI=1S/C17H19F3N4O2/c1-10-5-12(6-15(25)21-10)16(26)23(2)7-11-3-4-14-22-13(17(18,19)20)9-24(14)8-11/h5-6,9,11H,3-4,7-8H2,1-2H3,(H,21,25)/t11-/m1/s1 |
| InChIKey | AFLHNNWZFNCMTQ-LLVKDONJSA-N |
| XLogP | 2.23 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |