C16H22F3N3O2 — CID 129328518
(2S,3R)-N,2-dimethyl-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]oxolane-3-carboxamide (PubChem CID 129328518) has the molecular formula C16H22F3N3O2 and a molecular weight of 345.37 g/mol. Its IUPAC name is (2S,3R)-N,2-dimethyl-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]oxolane-3-carboxamide.
| Compound Name | (2S,3R)-N,2-dimethyl-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 129328518 |
| Molecular Formula | C16H22F3N3O2 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (2S,3R)-N,2-dimethyl-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]oxolane-3-carboxamide |
| SMILES | C[C@@H]1OCC[C@H]1C(=O)N(C)C[C@H]1CCc2nc(C(F)(F)F)cn2C1 |
| InChI | InChI=1S/C16H22F3N3O2/c1-10-12(5-6-24-10)15(23)21(2)7-11-3-4-14-20-13(16(17,18)19)9-22(14)8-11/h9-12H,3-8H2,1-2H3/t10-,11+,12+/m0/s1 |
| InChIKey | BNIDGKFFCOFMND-QJPTWQEYSA-N |
| XLogP | 2.35 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |