C16H22N4OS — CID 129328717
N,2,5-trimethyl-N-[[(4S)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]methyl]pyrazole-3-carboxamide (PubChem CID 129328717) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is N,2,5-trimethyl-N-[[(4S)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]methyl]pyrazole-3-carboxamide.
| Compound Name | N,2,5-trimethyl-N-[[(4S)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 129328717 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N,2,5-trimethyl-N-[[(4S)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]methyl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)C[C@@H]2CCCc3sc(C)nc32)n(C)n1 |
| InChI | InChI=1S/C16H22N4OS/c1-10-8-13(20(4)18-10)16(21)19(3)9-12-6-5-7-14-15(12)17-11(2)22-14/h8,12H,5-7,9H2,1-4H3/t12-/m0/s1 |
| InChIKey | CDKDVIRCVSHTKO-LBPRGKRZSA-N |
| XLogP | 2.69 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |