C15H23N7O — CID 129328776
(3R)-4-ethyl-3-(1H-imidazol-2-yl)-N-(2-imidazol-1-ylethyl)piperazine-1-carboxamide (PubChem CID 129328776) has the molecular formula C15H23N7O and a molecular weight of 317.40 g/mol. Its IUPAC name is (3R)-4-ethyl-3-(1H-imidazol-2-yl)-N-(2-imidazol-1-ylethyl)piperazine-1-carboxamide.
| Compound Name | (3R)-4-ethyl-3-(1H-imidazol-2-yl)-N-(2-imidazol-1-ylethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 129328776 |
| Molecular Formula | C15H23N7O |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | (3R)-4-ethyl-3-(1H-imidazol-2-yl)-N-(2-imidazol-1-ylethyl)piperazine-1-carboxamide |
| SMILES | CCN1CCN(C(=O)NCCn2ccnc2)C[C@@H]1c1ncc[nH]1 |
| InChI | InChI=1S/C15H23N7O/c1-2-21-9-10-22(11-13(21)14-17-3-4-18-14)15(23)19-6-8-20-7-5-16-12-20/h3-5,7,12-13H,2,6,8-11H2,1H3,(H,17,18)(H,19,23)/t13-/m1/s1 |
| InChIKey | CHJFHPZVHLRBFZ-CYBMUJFWSA-N |
| XLogP | 0.69 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |