C19H31N3 — CID 129330781
(2S)-6-methyl-N-[[(2R,3S)-1-methyl-2-pyridin-3-ylpyrrolidin-3-yl]methyl]hept-5-en-2-amine (PubChem CID 129330781) has the molecular formula C19H31N3 and a molecular weight of 301.48 g/mol. Its IUPAC name is (2S)-6-methyl-N-[[(2R,3S)-1-methyl-2-pyridin-3-ylpyrrolidin-3-yl]methyl]hept-5-en-2-amine.
| Compound Name | (2S)-6-methyl-N-[[(2R,3S)-1-methyl-2-pyridin-3-ylpyrrolidin-3-yl]methyl]hept-5-en-2-amine |
|---|---|
| PubChem CID | 129330781 |
| Molecular Formula | C19H31N3 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.25 |
| IUPAC Name | (2S)-6-methyl-N-[[(2R,3S)-1-methyl-2-pyridin-3-ylpyrrolidin-3-yl]methyl]hept-5-en-2-amine |
| SMILES | CC(C)=CCC[C@H](C)NC[C@@H]1CCN(C)[C@H]1c1cccnc1 |
| InChI | InChI=1S/C19H31N3/c1-15(2)7-5-8-16(3)21-14-18-10-12-22(4)19(18)17-9-6-11-20-13-17/h6-7,9,11,13,16,18-19,21H,5,8,10,12,14H2,1-4H3/t16-,18-,19-/m0/s1 |
| InChIKey | BGCGGGJHKWUTQB-WDSOQIARSA-N |
| XLogP | 3.80 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|