About (2R)-4-(3,4-dihydronaphthalen-2-ylsulfonyl)-2-(1H-imidazol-2-yl)-1-methylpiperazine
(2R)-4-(3,4-dihydronaphthalen-2-ylsulfonyl)-2-(1H-imidazol-2-yl)-1-methylpiperazine (PubChem CID 129331137) has the molecular formula C18H22N4O2S
and a molecular weight of 358.47 g/mol. Its IUPAC name is (2R)-4-(3,4-dihydronaphthalen-2-ylsulfonyl)-2-(1H-imidazol-2-yl)-1-methylpiperazine.
Molecular Properties
| Compound Name | (2R)-4-(3,4-dihydronaphthalen-2-ylsulfonyl)-2-(1H-imidazol-2-yl)-1-methylpiperazine |
| PubChem CID | 129331137 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (2R)-4-(3,4-dihydronaphthalen-2-ylsulfonyl)-2-(1H-imidazol-2-yl)-1-methylpiperazine |
| SMILES | CN1CCN(S(=O)(=O)C2=Cc3ccccc3CC2)C[C@@H]1c1ncc[nH]1 |
| InChI | InChI=1S/C18H22N4O2S/c1-21-10-11-22(13-17(21)18-19-8-9-20-18)25(23,24)16-7-6-14-4-2-3-5-15(14)12-16/h2-5,8-9,12,17H,6-7,10-11,13H2,1H3,(H,19,20)/t17-/m1/s1 |
| InChIKey | IYTXJTVRBVUNOP-QGZVFWFLSA-N |
| XLogP | 2.02 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-4-(3,4-dihydronaphthalen-2-ylsulfonyl)-2-(1H-imidazol-2-yl)-1-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-(3,4-dihydronaphthalen-2-ylsulfonyl)-2-(1H-imidazol-2-yl)-1-methylpiperazine?
The IUPAC name of (2R)-4-(3,4-dihydronaphthalen-2-ylsulfonyl)-2-(1H-imidazol-2-yl)-1-methylpiperazine (CID 129331137) is (2R)-4-(3,4-dihydronaphthalen-2-ylsulfonyl)-2-(1H-imidazol-2-yl)-1-methylpiperazine.
What is the SMILES notation for (2R)-4-(3,4-dihydronaphthalen-2-ylsulfonyl)-2-(1H-imidazol-2-yl)-1-methylpiperazine?
The canonical SMILES for (2R)-4-(3,4-dihydronaphthalen-2-ylsulfonyl)-2-(1H-imidazol-2-yl)-1-methylpiperazine is CN1CCN(S(=O)(=O)C2=Cc3ccccc3CC2)C[C@@H]1c1ncc[nH]1.
What is the InChIKey of (2R)-4-(3,4-dihydronaphthalen-2-ylsulfonyl)-2-(1H-imidazol-2-yl)-1-methylpiperazine?
The InChIKey is IYTXJTVRBVUNOP-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H22N4O2S/c1-21-10-11-22(13-17(21)18-19-8-9-20-18)25(23,24)16-7-6-14-4-2-3-5-15(14)12-16/h2-5,8-9,12,17H,6-7,10-11,13H2,1H3,(H,19,20)/t17-/m1/s1.
What are the key properties of (2R)-4-(3,4-dihydronaphthalen-2-ylsulfonyl)-2-(1H-imidazol-2-yl)-1-methylpiperazine?
(2R)-4-(3,4-dihydronaphthalen-2-ylsulfonyl)-2-(1H-imidazol-2-yl)-1-methylpiperazine has a molecular weight of 358.47 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-(3,4-dihydronaphthalen-2-ylsulfonyl)-2-(1H-imidazol-2-yl)-1-methylpiperazine is sourced from PubChem (CID 129331137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).