C19H31N5O — CID 129331565
3-[(1R)-cyclohex-2-en-1-yl]-1-methyl-1-[[(2R,3S)-1-methyl-2-(1-methylpyrazol-4-yl)piperidin-3-yl]methyl]urea (PubChem CID 129331565) has the molecular formula C19H31N5O and a molecular weight of 345.49 g/mol. Its IUPAC name is 3-[(1R)-cyclohex-2-en-1-yl]-1-methyl-1-[[(2R,3S)-1-methyl-2-(1-methylpyrazol-4-yl)piperidin-3-yl]methyl]urea.
| Compound Name | 3-[(1R)-cyclohex-2-en-1-yl]-1-methyl-1-[[(2R,3S)-1-methyl-2-(1-methylpyrazol-4-yl)piperidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 129331565 |
| Molecular Formula | C19H31N5O |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | 3-[(1R)-cyclohex-2-en-1-yl]-1-methyl-1-[[(2R,3S)-1-methyl-2-(1-methylpyrazol-4-yl)piperidin-3-yl]methyl]urea |
| SMILES | CN(C[C@@H]1CCCN(C)[C@H]1c1cnn(C)c1)C(=O)N[C@H]1C=CCCC1 |
| InChI | InChI=1S/C19H31N5O/c1-22-11-7-8-15(18(22)16-12-20-24(3)14-16)13-23(2)19(25)21-17-9-5-4-6-10-17/h5,9,12,14-15,17-18H,4,6-8,10-11,13H2,1-3H3,(H,21,25)/t15-,17-,18+/m0/s1 |
| InChIKey | JPPHCQUTQQSWSE-RYQLBKOJSA-N |
| XLogP | 2.55 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|