C10H7N7 — CID 12933159
10-methyl-2,3,4,5,8,9,11-heptazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7,9,12,14-heptaene (PubChem CID 12933159) has the molecular formula C10H7N7 and a molecular weight of 225.22 g/mol. Its IUPAC name is 10-methyl-2,3,4,5,8,9,11-heptazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7,9,12,14-heptaene.
| Compound Name | 10-methyl-2,3,4,5,8,9,11-heptazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7,9,12,14-heptaene |
|---|---|
| PubChem CID | 12933159 |
| Molecular Formula | C10H7N7 |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 10-methyl-2,3,4,5,8,9,11-heptazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,7,9,12,14-heptaene |
| SMILES | Cc1nnc2c3nnnn3c3ccccc3n12 |
| InChI | InChI=1S/C10H7N7/c1-6-11-12-9-10-13-14-15-17(10)8-5-3-2-4-7(8)16(6)9/h2-5H,1H3 |
| InChIKey | VYUIZMFBSSPOLP-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 73.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |