C22H30N4O — CID 129331746
(4S,5R)-1-methyl-4-[[[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]methyl]-5-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-2-one (PubChem CID 129331746) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is (4S,5R)-1-methyl-4-[[[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]methyl]-5-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-2-one.
| Compound Name | (4S,5R)-1-methyl-4-[[[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]methyl]-5-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 129331746 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | (4S,5R)-1-methyl-4-[[[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]amino]methyl]-5-(1,3,5-trimethylpyrazol-4-yl)pyrrolidin-2-one |
| SMILES | Cc1nn(C)c(C)c1[C@H]1[C@H](CN[C@H]2CCc3ccccc3C2)CC(=O)N1C |
| InChI | InChI=1S/C22H30N4O/c1-14-21(15(2)26(4)24-14)22-18(12-20(27)25(22)3)13-23-19-10-9-16-7-5-6-8-17(16)11-19/h5-8,18-19,22-23H,9-13H2,1-4H3/t18-,19-,22+/m0/s1 |
| InChIKey | JYGWJPKXFRYJLQ-CNNODRBYSA-N |
| XLogP | 2.70 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |