About (1-acetyl-4,5,6,7-tetrahydroindazol-3-yl)methyl acetate
(1-acetyl-4,5,6,7-tetrahydroindazol-3-yl)methyl acetate (PubChem CID 12933226) has the molecular formula C12H16N2O3
and a molecular weight of 236.27 g/mol. Its IUPAC name is (1-acetyl-4,5,6,7-tetrahydroindazol-3-yl)methyl acetate.
Molecular Properties
| Compound Name | (1-acetyl-4,5,6,7-tetrahydroindazol-3-yl)methyl acetate |
| PubChem CID | 12933226 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (1-acetyl-4,5,6,7-tetrahydroindazol-3-yl)methyl acetate |
| SMILES | CC(=O)OCc1nn(C(C)=O)c2c1CCCC2 |
| InChI | InChI=1S/C12H16N2O3/c1-8(15)14-12-6-4-3-5-10(12)11(13-14)7-17-9(2)16/h3-7H2,1-2H3 |
| InChIKey | IBULGFROAHXRIN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-acetyl-4,5,6,7-tetrahydroindazol-3-yl)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-acetyl-4,5,6,7-tetrahydroindazol-3-yl)methyl acetate?
The IUPAC name of (1-acetyl-4,5,6,7-tetrahydroindazol-3-yl)methyl acetate (CID 12933226) is (1-acetyl-4,5,6,7-tetrahydroindazol-3-yl)methyl acetate.
What is the SMILES notation for (1-acetyl-4,5,6,7-tetrahydroindazol-3-yl)methyl acetate?
The canonical SMILES for (1-acetyl-4,5,6,7-tetrahydroindazol-3-yl)methyl acetate is CC(=O)OCc1nn(C(C)=O)c2c1CCCC2.
What is the InChIKey of (1-acetyl-4,5,6,7-tetrahydroindazol-3-yl)methyl acetate?
The InChIKey is IBULGFROAHXRIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O3/c1-8(15)14-12-6-4-3-5-10(12)11(13-14)7-17-9(2)16/h3-7H2,1-2H3.
What are the key properties of (1-acetyl-4,5,6,7-tetrahydroindazol-3-yl)methyl acetate?
(1-acetyl-4,5,6,7-tetrahydroindazol-3-yl)methyl acetate has a molecular weight of 236.27 g/mol, XLogP of 1.49, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-acetyl-4,5,6,7-tetrahydroindazol-3-yl)methyl acetate is sourced from PubChem (CID 12933226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).