C13H16ClN5 — CID 12933335
4-chloro-N'-(3,5-diethyl-1,2,4-triazol-4-yl)benzenecarboximidamide (PubChem CID 12933335) has the molecular formula C13H16ClN5 and a molecular weight of 277.76 g/mol. Its IUPAC name is 4-chloro-N'-(3,5-diethyl-1,2,4-triazol-4-yl)benzenecarboximidamide.
| Compound Name | 4-chloro-N'-(3,5-diethyl-1,2,4-triazol-4-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 12933335 |
| Molecular Formula | C13H16ClN5 |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4-chloro-N'-(3,5-diethyl-1,2,4-triazol-4-yl)benzenecarboximidamide |
| SMILES | CCc1nnc(CC)n1/N=C(\N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H16ClN5/c1-3-11-16-17-12(4-2)19(11)18-13(15)9-5-7-10(14)8-6-9/h5-8H,3-4H2,1-2H3,(H2,15,18) |
| InChIKey | HPPNJNRKLKREQX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|