About pyrazin-2-ylmethyl acetate
pyrazin-2-ylmethyl acetate (PubChem CID 12933345) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is pyrazin-2-ylmethyl acetate.
Molecular Properties
| Compound Name | pyrazin-2-ylmethyl acetate |
| PubChem CID | 12933345 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | pyrazin-2-ylmethyl acetate |
| SMILES | CC(=O)OCc1cnccn1 |
| InChI | InChI=1S/C7H8N2O2/c1-6(10)11-5-7-4-8-2-3-9-7/h2-4H,5H2,1H3 |
| InChIKey | KRXOROXNMQYVCJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrazin-2-ylmethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazin-2-ylmethyl acetate?
The IUPAC name of pyrazin-2-ylmethyl acetate (CID 12933345) is pyrazin-2-ylmethyl acetate.
What is the SMILES notation for pyrazin-2-ylmethyl acetate?
The canonical SMILES for pyrazin-2-ylmethyl acetate is CC(=O)OCc1cnccn1.
What is the InChIKey of pyrazin-2-ylmethyl acetate?
The InChIKey is KRXOROXNMQYVCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c1-6(10)11-5-7-4-8-2-3-9-7/h2-4H,5H2,1H3.
What are the key properties of pyrazin-2-ylmethyl acetate?
pyrazin-2-ylmethyl acetate has a molecular weight of 152.15 g/mol, XLogP of 0.54, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazin-2-ylmethyl acetate is sourced from PubChem (CID 12933345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).