C15H17N5S — CID 129333678
6-methyl-N-[[(6S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 129333678) has the molecular formula C15H17N5S and a molecular weight of 299.40 g/mol. Its IUPAC name is 6-methyl-N-[[(6S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-methyl-N-[[(6S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 129333678 |
| Molecular Formula | C15H17N5S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 6-methyl-N-[[(6S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc2c(NC[C@@H]3CCc4nccn4C3)ncnc2s1 |
| InChI | InChI=1S/C15H17N5S/c1-10-6-12-14(18-9-19-15(12)21-10)17-7-11-2-3-13-16-4-5-20(13)8-11/h4-6,9,11H,2-3,7-8H2,1H3,(H,17,18,19)/t11-/m0/s1 |
| InChIKey | MQFLWLYOFVJBRJ-NSHDSACASA-N |
| XLogP | 2.87 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |