C16H20F3N5O — CID 129334106
N,1,5-trimethyl-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]pyrazole-3-carboxamide (PubChem CID 129334106) has the molecular formula C16H20F3N5O and a molecular weight of 355.36 g/mol. Its IUPAC name is N,1,5-trimethyl-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]pyrazole-3-carboxamide.
| Compound Name | N,1,5-trimethyl-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 129334106 |
| Molecular Formula | C16H20F3N5O |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N,1,5-trimethyl-N-[[(6S)-2-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]methyl]pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)C[C@H]2CCc3nc(C(F)(F)F)cn3C2)nn1C |
| InChI | InChI=1S/C16H20F3N5O/c1-10-6-12(21-23(10)3)15(25)22(2)7-11-4-5-14-20-13(16(17,18)19)9-24(14)8-11/h6,9,11H,4-5,7-8H2,1-3H3/t11-/m1/s1 |
| InChIKey | NDNOQGZYDMJYEE-LLVKDONJSA-N |
| XLogP | 2.28 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |