C17H24N4OS — CID 129334416
N,1,3,5-tetramethyl-N-[[(4S)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]methyl]pyrazole-4-carboxamide (PubChem CID 129334416) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is N,1,3,5-tetramethyl-N-[[(4S)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]methyl]pyrazole-4-carboxamide.
| Compound Name | N,1,3,5-tetramethyl-N-[[(4S)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]methyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 129334416 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N,1,3,5-tetramethyl-N-[[(4S)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-4-yl]methyl]pyrazole-4-carboxamide |
| SMILES | Cc1nc2c(s1)CCC[C@H]2CN(C)C(=O)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C17H24N4OS/c1-10-15(11(2)21(5)19-10)17(22)20(4)9-13-7-6-8-14-16(13)18-12(3)23-14/h13H,6-9H2,1-5H3/t13-/m0/s1 |
| InChIKey | NPXYIKSMQDMKLT-ZDUSSCGKSA-N |
| XLogP | 2.99 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |