About 2-[[(2S)-4-(4-cyano-2,2-dimethylbutyl)morpholin-2-yl]methyl-methylamino]acetamide
2-[[(2S)-4-(4-cyano-2,2-dimethylbutyl)morpholin-2-yl]methyl-methylamino]acetamide (PubChem CID 129334529) has the molecular formula C15H28N4O2
and a molecular weight of 296.42 g/mol. Its IUPAC name is 2-[[(2S)-4-(4-cyano-2,2-dimethylbutyl)morpholin-2-yl]methyl-methylamino]acetamide.
Molecular Properties
| Compound Name | 2-[[(2S)-4-(4-cyano-2,2-dimethylbutyl)morpholin-2-yl]methyl-methylamino]acetamide |
| PubChem CID | 129334529 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 2-[[(2S)-4-(4-cyano-2,2-dimethylbutyl)morpholin-2-yl]methyl-methylamino]acetamide |
| SMILES | CN(CC(N)=O)C[C@H]1CN(CC(C)(C)CCC#N)CCO1 |
| InChI | InChI=1S/C15H28N4O2/c1-15(2,5-4-6-16)12-19-7-8-21-13(10-19)9-18(3)11-14(17)20/h13H,4-5,7-12H2,1-3H3,(H2,17,20)/t13-/m0/s1 |
| InChIKey | HIDNLUYYBJLEJI-ZDUSSCGKSA-N |
| XLogP | 0.43 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[(2S)-4-(4-cyano-2,2-dimethylbutyl)morpholin-2-yl]methyl-methylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(2S)-4-(4-cyano-2,2-dimethylbutyl)morpholin-2-yl]methyl-methylamino]acetamide?
The IUPAC name of 2-[[(2S)-4-(4-cyano-2,2-dimethylbutyl)morpholin-2-yl]methyl-methylamino]acetamide (CID 129334529) is 2-[[(2S)-4-(4-cyano-2,2-dimethylbutyl)morpholin-2-yl]methyl-methylamino]acetamide.
What is the SMILES notation for 2-[[(2S)-4-(4-cyano-2,2-dimethylbutyl)morpholin-2-yl]methyl-methylamino]acetamide?
The canonical SMILES for 2-[[(2S)-4-(4-cyano-2,2-dimethylbutyl)morpholin-2-yl]methyl-methylamino]acetamide is CN(CC(N)=O)C[C@H]1CN(CC(C)(C)CCC#N)CCO1.
What is the InChIKey of 2-[[(2S)-4-(4-cyano-2,2-dimethylbutyl)morpholin-2-yl]methyl-methylamino]acetamide?
The InChIKey is HIDNLUYYBJLEJI-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H28N4O2/c1-15(2,5-4-6-16)12-19-7-8-21-13(10-19)9-18(3)11-14(17)20/h13H,4-5,7-12H2,1-3H3,(H2,17,20)/t13-/m0/s1.
What are the key properties of 2-[[(2S)-4-(4-cyano-2,2-dimethylbutyl)morpholin-2-yl]methyl-methylamino]acetamide?
2-[[(2S)-4-(4-cyano-2,2-dimethylbutyl)morpholin-2-yl]methyl-methylamino]acetamide has a molecular weight of 296.42 g/mol, XLogP of 0.43, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2S)-4-(4-cyano-2,2-dimethylbutyl)morpholin-2-yl]methyl-methylamino]acetamide is sourced from PubChem (CID 129334529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).