C17H22N4O4S — CID 129334685
[(3S)-3-(1-ethylpyrazol-4-yl)-1,1-dioxo-1,4-thiazinan-4-yl]-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl)methanone (PubChem CID 129334685) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is [(3S)-3-(1-ethylpyrazol-4-yl)-1,1-dioxo-1,4-thiazinan-4-yl]-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl)methanone.
| Compound Name | [(3S)-3-(1-ethylpyrazol-4-yl)-1,1-dioxo-1,4-thiazinan-4-yl]-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl)methanone |
|---|---|
| PubChem CID | 129334685 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | [(3S)-3-(1-ethylpyrazol-4-yl)-1,1-dioxo-1,4-thiazinan-4-yl]-(4,5,6,7-tetrahydro-1,2-benzoxazol-3-yl)methanone |
| SMILES | CCn1cc([C@H]2CS(=O)(=O)CCN2C(=O)c2noc3c2CCCC3)cn1 |
| InChI | InChI=1S/C17H22N4O4S/c1-2-20-10-12(9-18-20)14-11-26(23,24)8-7-21(14)17(22)16-13-5-3-4-6-15(13)25-19-16/h9-10,14H,2-8,11H2,1H3/t14-/m1/s1 |
| InChIKey | NYRISZWSZBENIN-CQSZACIVSA-N |
| XLogP | 1.38 |
| TPSA | 98.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |