C13H9F17O2 — CID 12933494
2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl)-1,4-dioxane (PubChem CID 12933494) has the molecular formula C13H9F17O2 and a molecular weight of 520.18 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl)-1,4-dioxane.
| Compound Name | 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl)-1,4-dioxane |
|---|---|
| PubChem CID | 12933494 |
| Molecular Formula | C13H9F17O2 |
| Molecular Weight | 520.18 g/mol |
| Exact Mass | 520.03 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluorononyl)-1,4-dioxane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC1COCCO1 |
| InChI | InChI=1S/C13H9F17O2/c14-6(15,3-5-4-31-1-2-32-5)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30/h5H,1-4H2 |
| InChIKey | GWJDQWCGMISTHV-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.18 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|