C21H34N4O — CID 129335154
(4S,5R)-4-[[[(1S,6R,7S)-8,8-dimethyl-7-bicyclo[4.2.0]octanyl]amino]methyl]-5-(1,5-dimethylpyrazol-4-yl)-1-methylpyrrolidin-2-one (PubChem CID 129335154) has the molecular formula C21H34N4O and a molecular weight of 358.53 g/mol. Its IUPAC name is (4S,5R)-4-[[[(1S,6R,7S)-8,8-dimethyl-7-bicyclo[4.2.0]octanyl]amino]methyl]-5-(1,5-dimethylpyrazol-4-yl)-1-methylpyrrolidin-2-one.
| Compound Name | (4S,5R)-4-[[[(1S,6R,7S)-8,8-dimethyl-7-bicyclo[4.2.0]octanyl]amino]methyl]-5-(1,5-dimethylpyrazol-4-yl)-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 129335154 |
| Molecular Formula | C21H34N4O |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.27 |
| IUPAC Name | (4S,5R)-4-[[[(1S,6R,7S)-8,8-dimethyl-7-bicyclo[4.2.0]octanyl]amino]methyl]-5-(1,5-dimethylpyrazol-4-yl)-1-methylpyrrolidin-2-one |
| SMILES | Cc1c([C@H]2[C@H](CN[C@H]3[C@@H]4CCCC[C@@H]4C3(C)C)CC(=O)N2C)cnn1C |
| InChI | InChI=1S/C21H34N4O/c1-13-16(12-23-25(13)5)19-14(10-18(26)24(19)4)11-22-20-15-8-6-7-9-17(15)21(20,2)3/h12,14-15,17,19-20,22H,6-11H2,1-5H3/t14-,15+,17-,19+,20-/m0/s1 |
| InChIKey | OUDHULFCOUSICS-VQJXYJGWSA-N |
| XLogP | 3.05 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |