C18H24N4OS — CID 129336414
N-(pyrimidin-5-ylmethyl)-N-[(4S)-1-(thiophen-3-ylmethyl)azepan-4-yl]acetamide (PubChem CID 129336414) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is N-(pyrimidin-5-ylmethyl)-N-[(4S)-1-(thiophen-3-ylmethyl)azepan-4-yl]acetamide.
| Compound Name | N-(pyrimidin-5-ylmethyl)-N-[(4S)-1-(thiophen-3-ylmethyl)azepan-4-yl]acetamide |
|---|---|
| PubChem CID | 129336414 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-(pyrimidin-5-ylmethyl)-N-[(4S)-1-(thiophen-3-ylmethyl)azepan-4-yl]acetamide |
| SMILES | CC(=O)N(Cc1cncnc1)[C@H]1CCCN(Cc2ccsc2)CC1 |
| InChI | InChI=1S/C18H24N4OS/c1-15(23)22(12-17-9-19-14-20-10-17)18-3-2-6-21(7-4-18)11-16-5-8-24-13-16/h5,8-10,13-14,18H,2-4,6-7,11-12H2,1H3/t18-/m0/s1 |
| InChIKey | KDBFGEOVOPWUGR-SFHVURJKSA-N |
| XLogP | 2.94 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |