C15H20N4OS — CID 129336482
N,2,4-trimethyl-N-[[(7S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methyl]-1,3-thiazole-5-carboxamide (PubChem CID 129336482) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is N,2,4-trimethyl-N-[[(7S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N,2,4-trimethyl-N-[[(7S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 129336482 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N,2,4-trimethyl-N-[[(7S)-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-7-yl]methyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)N(C)C[C@H]2CCn3ccnc3C2)s1 |
| InChI | InChI=1S/C15H20N4OS/c1-10-14(21-11(2)17-10)15(20)18(3)9-12-4-6-19-7-5-16-13(19)8-12/h5,7,12H,4,6,8-9H2,1-3H3/t12-/m0/s1 |
| InChIKey | QREFJQKJFUTWIN-LBPRGKRZSA-N |
| XLogP | 2.29 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |