C22H28N6O — CID 129336500
4-[[5-[(3R)-1-(8-methylquinazolin-4-yl)piperidin-3-yl]-1H-pyrazol-4-yl]methyl]morpholine (PubChem CID 129336500) has the molecular formula C22H28N6O and a molecular weight of 392.51 g/mol. Its IUPAC name is 4-[[5-[(3R)-1-(8-methylquinazolin-4-yl)piperidin-3-yl]-1H-pyrazol-4-yl]methyl]morpholine.
| Compound Name | 4-[[5-[(3R)-1-(8-methylquinazolin-4-yl)piperidin-3-yl]-1H-pyrazol-4-yl]methyl]morpholine |
|---|---|
| PubChem CID | 129336500 |
| Molecular Formula | C22H28N6O |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 4-[[5-[(3R)-1-(8-methylquinazolin-4-yl)piperidin-3-yl]-1H-pyrazol-4-yl]methyl]morpholine |
| SMILES | Cc1cccc2c(N3CCC[C@@H](c4[nH]ncc4CN4CCOCC4)C3)ncnc12 |
| InChI | InChI=1S/C22H28N6O/c1-16-4-2-6-19-20(16)23-15-24-22(19)28-7-3-5-17(14-28)21-18(12-25-26-21)13-27-8-10-29-11-9-27/h2,4,6,12,15,17H,3,5,7-11,13-14H2,1H3,(H,25,26)/t17-/m1/s1 |
| InChIKey | QTDDXCYLMCHEEU-QGZVFWFLSA-N |
| XLogP | 2.88 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |