C17H27N3O2 — CID 129340767
(2S)-2-[[acetyl(cyclopropyl)amino]methyl]-N-[(1S)-cyclohex-2-en-1-yl]pyrrolidine-1-carboxamide (PubChem CID 129340767) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is (2S)-2-[[acetyl(cyclopropyl)amino]methyl]-N-[(1S)-cyclohex-2-en-1-yl]pyrrolidine-1-carboxamide.
| Compound Name | (2S)-2-[[acetyl(cyclopropyl)amino]methyl]-N-[(1S)-cyclohex-2-en-1-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 129340767 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | (2S)-2-[[acetyl(cyclopropyl)amino]methyl]-N-[(1S)-cyclohex-2-en-1-yl]pyrrolidine-1-carboxamide |
| SMILES | CC(=O)N(C[C@@H]1CCCN1C(=O)N[C@@H]1C=CCCC1)C1CC1 |
| InChI | InChI=1S/C17H27N3O2/c1-13(21)20(15-9-10-15)12-16-8-5-11-19(16)17(22)18-14-6-3-2-4-7-14/h3,6,14-16H,2,4-5,7-12H2,1H3,(H,18,22)/t14-,16+/m1/s1 |
| InChIKey | QNVZHMKNMRYZHZ-ZBFHGGJFSA-N |
| XLogP | 2.28 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|