C18H29N3O3S — CID 129341023
N-cyclobutyl-N-[(4R)-1-[(4-methoxy-2-pyridinyl)methyl]azepan-4-yl]methanesulfonamide (PubChem CID 129341023) has the molecular formula C18H29N3O3S and a molecular weight of 367.52 g/mol. Its IUPAC name is N-cyclobutyl-N-[(4R)-1-[(4-methoxy-2-pyridinyl)methyl]azepan-4-yl]methanesulfonamide.
| Compound Name | N-cyclobutyl-N-[(4R)-1-[(4-methoxy-2-pyridinyl)methyl]azepan-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 129341023 |
| Molecular Formula | C18H29N3O3S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | N-cyclobutyl-N-[(4R)-1-[(4-methoxy-2-pyridinyl)methyl]azepan-4-yl]methanesulfonamide |
| SMILES | COc1ccnc(CN2CCC[C@@H](N(C3CCC3)S(C)(=O)=O)CC2)c1 |
| InChI | InChI=1S/C18H29N3O3S/c1-24-18-8-10-19-15(13-18)14-20-11-4-7-17(9-12-20)21(25(2,22)23)16-5-3-6-16/h8,10,13,16-17H,3-7,9,11-12,14H2,1-2H3/t17-/m1/s1 |
| InChIKey | QWSNNZCBSLFKSD-QGZVFWFLSA-N |
| XLogP | 2.26 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |