About 4-N-methyl-6-N-[(3R)-oxan-3-yl]-4-N-(2-pyrazol-1-ylethyl)pyrimidine-4,6-diamine
4-N-methyl-6-N-[(3R)-oxan-3-yl]-4-N-(2-pyrazol-1-ylethyl)pyrimidine-4,6-diamine (PubChem CID 129341786) has the molecular formula C15H22N6O
and a molecular weight of 302.38 g/mol. Its IUPAC name is 4-N-methyl-6-N-[(3R)-oxan-3-yl]-4-N-(2-pyrazol-1-ylethyl)pyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 4-N-methyl-6-N-[(3R)-oxan-3-yl]-4-N-(2-pyrazol-1-ylethyl)pyrimidine-4,6-diamine |
| PubChem CID | 129341786 |
| Molecular Formula | C15H22N6O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 4-N-methyl-6-N-[(3R)-oxan-3-yl]-4-N-(2-pyrazol-1-ylethyl)pyrimidine-4,6-diamine |
| SMILES | CN(CCn1cccn1)c1cc(N[C@@H]2CCCOC2)ncn1 |
| InChI | InChI=1S/C15H22N6O/c1-20(7-8-21-6-3-5-18-21)15-10-14(16-12-17-15)19-13-4-2-9-22-11-13/h3,5-6,10,12-13H,2,4,7-9,11H2,1H3,(H,16,17,19)/t13-/m1/s1 |
| InChIKey | RWSMNRNHIAHIIZ-CYBMUJFWSA-N |
| XLogP | 1.40 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-N-methyl-6-N-[(3R)-oxan-3-yl]-4-N-(2-pyrazol-1-ylethyl)pyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-methyl-6-N-[(3R)-oxan-3-yl]-4-N-(2-pyrazol-1-ylethyl)pyrimidine-4,6-diamine?
The IUPAC name of 4-N-methyl-6-N-[(3R)-oxan-3-yl]-4-N-(2-pyrazol-1-ylethyl)pyrimidine-4,6-diamine (CID 129341786) is 4-N-methyl-6-N-[(3R)-oxan-3-yl]-4-N-(2-pyrazol-1-ylethyl)pyrimidine-4,6-diamine.
What is the SMILES notation for 4-N-methyl-6-N-[(3R)-oxan-3-yl]-4-N-(2-pyrazol-1-ylethyl)pyrimidine-4,6-diamine?
The canonical SMILES for 4-N-methyl-6-N-[(3R)-oxan-3-yl]-4-N-(2-pyrazol-1-ylethyl)pyrimidine-4,6-diamine is CN(CCn1cccn1)c1cc(N[C@@H]2CCCOC2)ncn1.
What is the InChIKey of 4-N-methyl-6-N-[(3R)-oxan-3-yl]-4-N-(2-pyrazol-1-ylethyl)pyrimidine-4,6-diamine?
The InChIKey is RWSMNRNHIAHIIZ-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H22N6O/c1-20(7-8-21-6-3-5-18-21)15-10-14(16-12-17-15)19-13-4-2-9-22-11-13/h3,5-6,10,12-13H,2,4,7-9,11H2,1H3,(H,16,17,19)/t13-/m1/s1.
What are the key properties of 4-N-methyl-6-N-[(3R)-oxan-3-yl]-4-N-(2-pyrazol-1-ylethyl)pyrimidine-4,6-diamine?
4-N-methyl-6-N-[(3R)-oxan-3-yl]-4-N-(2-pyrazol-1-ylethyl)pyrimidine-4,6-diamine has a molecular weight of 302.38 g/mol, XLogP of 1.40, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-methyl-6-N-[(3R)-oxan-3-yl]-4-N-(2-pyrazol-1-ylethyl)pyrimidine-4,6-diamine is sourced from PubChem (CID 129341786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).