About (3R)-N-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]thian-3-amine
(3R)-N-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]thian-3-amine (PubChem CID 129343353) has the molecular formula C15H25N3OS
and a molecular weight of 295.45 g/mol. Its IUPAC name is (3R)-N-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]thian-3-amine.
Molecular Properties
| Compound Name | (3R)-N-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]thian-3-amine |
| PubChem CID | 129343353 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | (3R)-N-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]thian-3-amine |
| SMILES | CCn1nccc1[C@@H]1OCC[C@H]1CN[C@@H]1CCCSC1 |
| InChI | InChI=1S/C15H25N3OS/c1-2-18-14(5-7-17-18)15-12(6-8-19-15)10-16-13-4-3-9-20-11-13/h5,7,12-13,15-16H,2-4,6,8-11H2,1H3/t12-,13+,15+/m0/s1 |
| InChIKey | WNNKQTLOLLJXKS-GZBFAFLISA-N |
| XLogP | 2.47 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3R)-N-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]thian-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-N-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]thian-3-amine?
The IUPAC name of (3R)-N-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]thian-3-amine (CID 129343353) is (3R)-N-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]thian-3-amine.
What is the SMILES notation for (3R)-N-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]thian-3-amine?
The canonical SMILES for (3R)-N-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]thian-3-amine is CCn1nccc1[C@@H]1OCC[C@H]1CN[C@@H]1CCCSC1.
What is the InChIKey of (3R)-N-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]thian-3-amine?
The InChIKey is WNNKQTLOLLJXKS-GZBFAFLISA-N. The full InChI is InChI=1S/C15H25N3OS/c1-2-18-14(5-7-17-18)15-12(6-8-19-15)10-16-13-4-3-9-20-11-13/h5,7,12-13,15-16H,2-4,6,8-11H2,1H3/t12-,13+,15+/m0/s1.
What are the key properties of (3R)-N-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]thian-3-amine?
(3R)-N-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]thian-3-amine has a molecular weight of 295.45 g/mol, XLogP of 2.47, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-N-[[(2R,3S)-2-(2-ethylpyrazol-3-yl)oxolan-3-yl]methyl]thian-3-amine is sourced from PubChem (CID 129343353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).