C16H28N4O3S — CID 129343540
5-[(2R)-1-[3-(methanesulfonamido)propyl]piperidin-2-yl]-N,1-dimethylpyrrole-2-carboxamide (PubChem CID 129343540) has the molecular formula C16H28N4O3S and a molecular weight of 356.49 g/mol. Its IUPAC name is 5-[(2R)-1-[3-(methanesulfonamido)propyl]piperidin-2-yl]-N,1-dimethylpyrrole-2-carboxamide.
| Compound Name | 5-[(2R)-1-[3-(methanesulfonamido)propyl]piperidin-2-yl]-N,1-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 129343540 |
| Molecular Formula | C16H28N4O3S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 5-[(2R)-1-[3-(methanesulfonamido)propyl]piperidin-2-yl]-N,1-dimethylpyrrole-2-carboxamide |
| SMILES | CNC(=O)c1ccc([C@H]2CCCCN2CCCNS(C)(=O)=O)n1C |
| InChI | InChI=1S/C16H28N4O3S/c1-17-16(21)15-9-8-13(19(15)2)14-7-4-5-11-20(14)12-6-10-18-24(3,22)23/h8-9,14,18H,4-7,10-12H2,1-3H3,(H,17,21)/t14-/m1/s1 |
| InChIKey | WXXXBTYHIXXATG-CQSZACIVSA-N |
| XLogP | 0.85 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|