C18H26N6O3 — CID 129343667
(5S)-5-[2-[(4S)-4-[[6-(dimethylamino)-3-pyridinyl]amino]azepan-1-yl]-2-oxoethyl]imidazolidine-2,4-dione (PubChem CID 129343667) has the molecular formula C18H26N6O3 and a molecular weight of 374.45 g/mol. Its IUPAC name is (5S)-5-[2-[(4S)-4-[[6-(dimethylamino)-3-pyridinyl]amino]azepan-1-yl]-2-oxoethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[2-[(4S)-4-[[6-(dimethylamino)-3-pyridinyl]amino]azepan-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 129343667 |
| Molecular Formula | C18H26N6O3 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (5S)-5-[2-[(4S)-4-[[6-(dimethylamino)-3-pyridinyl]amino]azepan-1-yl]-2-oxoethyl]imidazolidine-2,4-dione |
| SMILES | CN(C)c1ccc(N[C@H]2CCCN(C(=O)C[C@@H]3NC(=O)NC3=O)CC2)cn1 |
| InChI | InChI=1S/C18H26N6O3/c1-23(2)15-6-5-13(11-19-15)20-12-4-3-8-24(9-7-12)16(25)10-14-17(26)22-18(27)21-14/h5-6,11-12,14,20H,3-4,7-10H2,1-2H3,(H2,21,22,26,27)/t12-,14-/m0/s1 |
| InChIKey | XEYGTTKCDBHGFX-JSGCOSHPSA-N |
| XLogP | 0.54 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|