C17H26N4O — CID 129343770
3-[4-[[(1S)-cyclohex-3-en-1-yl]methylamino]piperidin-1-yl]-1-methylpyrazin-2-one (PubChem CID 129343770) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 3-[4-[[(1S)-cyclohex-3-en-1-yl]methylamino]piperidin-1-yl]-1-methylpyrazin-2-one.
| Compound Name | 3-[4-[[(1S)-cyclohex-3-en-1-yl]methylamino]piperidin-1-yl]-1-methylpyrazin-2-one |
|---|---|
| PubChem CID | 129343770 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 3-[4-[[(1S)-cyclohex-3-en-1-yl]methylamino]piperidin-1-yl]-1-methylpyrazin-2-one |
| SMILES | Cn1ccnc(N2CCC(NC[C@@H]3CC=CCC3)CC2)c1=O |
| InChI | InChI=1S/C17H26N4O/c1-20-12-9-18-16(17(20)22)21-10-7-15(8-11-21)19-13-14-5-3-2-4-6-14/h2-3,9,12,14-15,19H,4-8,10-11,13H2,1H3/t14-/m1/s1 |
| InChIKey | XKQWNTMYPDQSMU-CQSZACIVSA-N |
| XLogP | 1.70 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|