C20H28FN5 — CID 129344227
(4S)-N-[(4-aminopyrimidin-2-yl)methyl]-1-[2-(2-fluorophenyl)ethyl]-N-methylazepan-4-amine (PubChem CID 129344227) has the molecular formula C20H28FN5 and a molecular weight of 357.48 g/mol. Its IUPAC name is (4S)-N-[(4-aminopyrimidin-2-yl)methyl]-1-[2-(2-fluorophenyl)ethyl]-N-methylazepan-4-amine.
| Compound Name | (4S)-N-[(4-aminopyrimidin-2-yl)methyl]-1-[2-(2-fluorophenyl)ethyl]-N-methylazepan-4-amine |
|---|---|
| PubChem CID | 129344227 |
| Molecular Formula | C20H28FN5 |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | (4S)-N-[(4-aminopyrimidin-2-yl)methyl]-1-[2-(2-fluorophenyl)ethyl]-N-methylazepan-4-amine |
| SMILES | CN(Cc1nccc(N)n1)[C@H]1CCCN(CCc2ccccc2F)CC1 |
| InChI | InChI=1S/C20H28FN5/c1-25(15-20-23-11-8-19(22)24-20)17-6-4-12-26(14-10-17)13-9-16-5-2-3-7-18(16)21/h2-3,5,7-8,11,17H,4,6,9-10,12-15H2,1H3,(H2,22,23,24)/t17-/m0/s1 |
| InChIKey | YVBBUVAVHYGDNK-KRWDZBQOSA-N |
| XLogP | 2.73 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |