About 5-tert-butyl-3-[[(3S)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]sulfonylmethyl]-1,2-oxazole
5-tert-butyl-3-[[(3S)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]sulfonylmethyl]-1,2-oxazole (PubChem CID 129344747) has the molecular formula C18H28N4O3S
and a molecular weight of 380.51 g/mol. Its IUPAC name is 5-tert-butyl-3-[[(3S)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]sulfonylmethyl]-1,2-oxazole.
Molecular Properties
| Compound Name | 5-tert-butyl-3-[[(3S)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]sulfonylmethyl]-1,2-oxazole |
| PubChem CID | 129344747 |
| Molecular Formula | C18H28N4O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 5-tert-butyl-3-[[(3S)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]sulfonylmethyl]-1,2-oxazole |
| SMILES | CCc1nccn1[C@H]1CCCN(S(=O)(=O)Cc2cc(C(C)(C)C)on2)C1 |
| InChI | InChI=1S/C18H28N4O3S/c1-5-17-19-8-10-22(17)15-7-6-9-21(12-15)26(23,24)13-14-11-16(25-20-14)18(2,3)4/h8,10-11,15H,5-7,9,12-13H2,1-4H3/t15-/m0/s1 |
| InChIKey | DMWYGTYVNHUOAO-HNNXBMFYSA-N |
| XLogP | 2.90 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-tert-butyl-3-[[(3S)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]sulfonylmethyl]-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-3-[[(3S)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]sulfonylmethyl]-1,2-oxazole?
The IUPAC name of 5-tert-butyl-3-[[(3S)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]sulfonylmethyl]-1,2-oxazole (CID 129344747) is 5-tert-butyl-3-[[(3S)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]sulfonylmethyl]-1,2-oxazole.
What is the SMILES notation for 5-tert-butyl-3-[[(3S)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]sulfonylmethyl]-1,2-oxazole?
The canonical SMILES for 5-tert-butyl-3-[[(3S)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]sulfonylmethyl]-1,2-oxazole is CCc1nccn1[C@H]1CCCN(S(=O)(=O)Cc2cc(C(C)(C)C)on2)C1.
What is the InChIKey of 5-tert-butyl-3-[[(3S)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]sulfonylmethyl]-1,2-oxazole?
The InChIKey is DMWYGTYVNHUOAO-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H28N4O3S/c1-5-17-19-8-10-22(17)15-7-6-9-21(12-15)26(23,24)13-14-11-16(25-20-14)18(2,3)4/h8,10-11,15H,5-7,9,12-13H2,1-4H3/t15-/m0/s1.
What are the key properties of 5-tert-butyl-3-[[(3S)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]sulfonylmethyl]-1,2-oxazole?
5-tert-butyl-3-[[(3S)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]sulfonylmethyl]-1,2-oxazole has a molecular weight of 380.51 g/mol, XLogP of 2.90, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-3-[[(3S)-3-(2-ethylimidazol-1-yl)piperidin-1-yl]sulfonylmethyl]-1,2-oxazole is sourced from PubChem (CID 129344747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).