C24H30N2O3 — CID 129345342
(1R,3aR,7aS)-N-cyclopentyl-N-[(2-methylquinolin-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyran-1-carboxamide (PubChem CID 129345342) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is (1R,3aR,7aS)-N-cyclopentyl-N-[(2-methylquinolin-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyran-1-carboxamide.
| Compound Name | (1R,3aR,7aS)-N-cyclopentyl-N-[(2-methylquinolin-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyran-1-carboxamide |
|---|---|
| PubChem CID | 129345342 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | (1R,3aR,7aS)-N-cyclopentyl-N-[(2-methylquinolin-4-yl)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyran-1-carboxamide |
| SMILES | Cc1cc(CN(C(=O)[C@@H]2OC[C@H]3COCC[C@@H]32)C2CCCC2)c2ccccc2n1 |
| InChI | InChI=1S/C24H30N2O3/c1-16-12-17(20-8-4-5-9-22(20)25-16)13-26(19-6-2-3-7-19)24(27)23-21-10-11-28-14-18(21)15-29-23/h4-5,8-9,12,18-19,21,23H,2-3,6-7,10-11,13-15H2,1H3/t18-,21+,23-/m1/s1 |
| InChIKey | VZSVWEYSMLYTLN-RZFNWQHOSA-N |
| XLogP | 3.87 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |